C17H17F5OS — CID 155206785
(2,2-diphenyl-2-prop-2-enoxyethyl)-pentafluoro-λ6-sulfane (PubChem CID 155206785) has the molecular formula C17H17F5OS and a molecular weight of 364.38 g/mol. Its IUPAC name is (2,2-diphenyl-2-prop-2-enoxyethyl)-pentafluoro-λ6-sulfane.
| Compound Name | (2,2-diphenyl-2-prop-2-enoxyethyl)-pentafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 155206785 |
| Molecular Formula | C17H17F5OS |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (2,2-diphenyl-2-prop-2-enoxyethyl)-pentafluoro-λ6-sulfane |
| SMILES | C=CCOC(CS(F)(F)(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17F5OS/c1-2-13-23-17(14-24(18,19,20,21)22,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h2-12H,1,13-14H2 |
| InChIKey | FRFFPZDVADQXPD-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|