C19H16O2 — CID 101099800
2-(3-methylbut-3-en-1-ynoxy)-2,2-diphenylacetaldehyde (PubChem CID 101099800) has the molecular formula C19H16O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(3-methylbut-3-en-1-ynoxy)-2,2-diphenylacetaldehyde.
| Compound Name | 2-(3-methylbut-3-en-1-ynoxy)-2,2-diphenylacetaldehyde |
|---|---|
| PubChem CID | 101099800 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-(3-methylbut-3-en-1-ynoxy)-2,2-diphenylacetaldehyde |
| SMILES | C=C(C)C#COC(C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16O2/c1-16(2)13-14-21-19(15-20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,15H,1H2,2H3 |
| InChIKey | CULBLYHAQJVSRA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|