C19H21NO4 — CID 177224766
1-(2-oxo-1,1-diphenylethoxy)ethyl 2-(methylamino)acetate (PubChem CID 177224766) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-(2-oxo-1,1-diphenylethoxy)ethyl 2-(methylamino)acetate.
| Compound Name | 1-(2-oxo-1,1-diphenylethoxy)ethyl 2-(methylamino)acetate |
|---|---|
| PubChem CID | 177224766 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(2-oxo-1,1-diphenylethoxy)ethyl 2-(methylamino)acetate |
| SMILES | CNCC(=O)OC(C)OC(C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO4/c1-15(23-18(22)13-20-2)24-19(14-21,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,14-15,20H,13H2,1-2H3 |
| InChIKey | KYJJDEMWTLUDRQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|