C16H23NO3Si — CID 101221460
[(E)-4-trimethylsilylbut-3-en-2-yl] 2-benzamidoacetate (PubChem CID 101221460) has the molecular formula C16H23NO3Si and a molecular weight of 305.45 g/mol. Its IUPAC name is [(E)-4-trimethylsilylbut-3-en-2-yl] 2-benzamidoacetate.
| Compound Name | [(E)-4-trimethylsilylbut-3-en-2-yl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 101221460 |
| Molecular Formula | C16H23NO3Si |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | [(E)-4-trimethylsilylbut-3-en-2-yl] 2-benzamidoacetate |
| SMILES | CC(/C=C/[Si](C)(C)C)OC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO3Si/c1-13(10-11-21(2,3)4)20-15(18)12-17-16(19)14-8-6-5-7-9-14/h5-11,13H,12H2,1-4H3,(H,17,19)/b11-10+ |
| InChIKey | ZVLSQRSVDXDICM-ZHACJKMWSA-N |
| XLogP | 2.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|