C18H16ClNO4 — CID 7889617
[(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-benzamidoacetate (PubChem CID 7889617) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is [(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-benzamidoacetate.
| Compound Name | [(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 7889617 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-benzamidoacetate |
| SMILES | C[C@@H](OC(=O)CNC(=O)c1ccccc1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClNO4/c1-12(17(22)13-7-9-15(19)10-8-13)24-16(21)11-20-18(23)14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | BNAQJXBWEJNVJH-GFCCVEGCSA-N |
| XLogP | 2.88 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |