C18H15ClFNO4 — CID 8521447
[(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 8521447) has the molecular formula C18H15ClFNO4 and a molecular weight of 363.77 g/mol. Its IUPAC name is [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8521447 |
| Molecular Formula | C18H15ClFNO4 |
| Molecular Weight | 363.77 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | C[C@H](OC(=O)CNC(=O)c1ccccc1F)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClFNO4/c1-11(17(23)12-6-8-13(19)9-7-12)25-16(22)10-21-18(24)14-4-2-3-5-15(14)20/h2-9,11H,10H2,1H3,(H,21,24)/t11-/m0/s1 |
| InChIKey | XSBCZVBCPKPVHE-NSHDSACASA-N |
| XLogP | 3.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |