C23H18O2 — CID 101099801
2-[2-(4-methylphenyl)ethynoxy]-2,2-diphenylacetaldehyde (PubChem CID 101099801) has the molecular formula C23H18O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)ethynoxy]-2,2-diphenylacetaldehyde.
| Compound Name | 2-[2-(4-methylphenyl)ethynoxy]-2,2-diphenylacetaldehyde |
|---|---|
| PubChem CID | 101099801 |
| Molecular Formula | C23H18O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[2-(4-methylphenyl)ethynoxy]-2,2-diphenylacetaldehyde |
| SMILES | Cc1ccc(C#COC(C=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18O2/c1-19-12-14-20(15-13-19)16-17-25-23(18-24,21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,18H,1H3 |
| InChIKey | MNAGFWPDIZPJKS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|