C20H19OP — CID 11055886
[[(1E)-2,5-dimethylhexa-1,5-dien-3-ynyl]-phenylphosphoryl]benzene (PubChem CID 11055886) has the molecular formula C20H19OP and a molecular weight of 306.35 g/mol. Its IUPAC name is [[(1E)-2,5-dimethylhexa-1,5-dien-3-ynyl]-phenylphosphoryl]benzene.
| Compound Name | [[(1E)-2,5-dimethylhexa-1,5-dien-3-ynyl]-phenylphosphoryl]benzene |
|---|---|
| PubChem CID | 11055886 |
| Molecular Formula | C20H19OP |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [[(1E)-2,5-dimethylhexa-1,5-dien-3-ynyl]-phenylphosphoryl]benzene |
| SMILES | C=C(C)C#C/C(C)=C/P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19OP/c1-17(2)14-15-18(3)16-22(21,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,16H,1H2,2-3H3/b18-16+ |
| InChIKey | PDZPHYKHUGCRQE-FBMGVBCBSA-N |
| XLogP | 4.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|