C18H22NOP — CID 91998631
(Z)-1-diphenylphosphoryl-3,3-dimethylbut-1-en-2-amine (PubChem CID 91998631) has the molecular formula C18H22NOP and a molecular weight of 299.35 g/mol. Its IUPAC name is (Z)-1-diphenylphosphoryl-3,3-dimethylbut-1-en-2-amine.
| Compound Name | (Z)-1-diphenylphosphoryl-3,3-dimethylbut-1-en-2-amine |
|---|---|
| PubChem CID | 91998631 |
| Molecular Formula | C18H22NOP |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (Z)-1-diphenylphosphoryl-3,3-dimethylbut-1-en-2-amine |
| SMILES | CC(C)(C)/C(N)=C/P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22NOP/c1-18(2,3)17(19)14-21(20,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14H,19H2,1-3H3/b17-14- |
| InChIKey | GEHDBMWXNCAFFF-VKAVYKQESA-N |
| XLogP | 3.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|