C28H24O2P2 — CID 102152479
[[(1E,3E)-4-diphenylphosphorylbuta-1,3-dienyl]-phenylphosphoryl]benzene (PubChem CID 102152479) has the molecular formula C28H24O2P2 and a molecular weight of 454.45 g/mol. Its IUPAC name is [[(1E,3E)-4-diphenylphosphorylbuta-1,3-dienyl]-phenylphosphoryl]benzene.
| Compound Name | [[(1E,3E)-4-diphenylphosphorylbuta-1,3-dienyl]-phenylphosphoryl]benzene |
|---|---|
| PubChem CID | 102152479 |
| Molecular Formula | C28H24O2P2 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [[(1E,3E)-4-diphenylphosphorylbuta-1,3-dienyl]-phenylphosphoryl]benzene |
| SMILES | O=P(/C=C/C=C/P(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24O2P2/c29-31(25-15-5-1-6-16-25,26-17-7-2-8-18-26)23-13-14-24-32(30,27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-24H/b23-13+,24-14+ |
| InChIKey | OPUUAVBTYKRNFD-RNIAWFEPSA-N |
| XLogP | 6.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|