C18H22NOP — CID 13215077
(E)-2-diphenylphosphoryl-N,N-diethylethenamine (PubChem CID 13215077) has the molecular formula C18H22NOP and a molecular weight of 299.35 g/mol. Its IUPAC name is (E)-2-diphenylphosphoryl-N,N-diethylethenamine.
| Compound Name | (E)-2-diphenylphosphoryl-N,N-diethylethenamine |
|---|---|
| PubChem CID | 13215077 |
| Molecular Formula | C18H22NOP |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (E)-2-diphenylphosphoryl-N,N-diethylethenamine |
| SMILES | CCN(/C=C/P(=O)(c1ccccc1)c1ccccc1)CC |
| InChI | InChI=1S/C18H22NOP/c1-3-19(4-2)15-16-21(20,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16H,3-4H2,1-2H3/b16-15+ |
| InChIKey | OUFWKVVNBYXMHZ-FOCLMDBBSA-N |
| XLogP | 3.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|