C21H30N2O2 — CID 160532713
N,N-dibenzylformamide;N,N-diethylformamide;methane (PubChem CID 160532713) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is N,N-dibenzylformamide;N,N-diethylformamide;methane.
| Compound Name | N,N-dibenzylformamide;N,N-diethylformamide;methane |
|---|---|
| PubChem CID | 160532713 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N,N-dibenzylformamide;N,N-diethylformamide;methane |
| SMILES | C.CCN(C=O)CC.O=CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H15NO.C5H11NO.CH4/c17-13-16(11-14-7-3-1-4-8-14)12-15-9-5-2-6-10-15;1-3-6(4-2)5-7;/h1-10,13H,11-12H2;5H,3-4H2,1-2H3;1H4 |
| InChIKey | QVTKBCVBAZSWAR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|