C16H23NO — CID 11288047
N-benzyl-N-(2-ethenyl-3-methylpentyl)formamide (PubChem CID 11288047) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is N-benzyl-N-(2-ethenyl-3-methylpentyl)formamide.
| Compound Name | N-benzyl-N-(2-ethenyl-3-methylpentyl)formamide |
|---|---|
| PubChem CID | 11288047 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-benzyl-N-(2-ethenyl-3-methylpentyl)formamide |
| SMILES | C=CC(CN(C=O)Cc1ccccc1)C(C)CC |
| InChI | InChI=1S/C16H23NO/c1-4-14(3)16(5-2)12-17(13-18)11-15-9-7-6-8-10-15/h5-10,13-14,16H,2,4,11-12H2,1,3H3 |
| InChIKey | YPJJCRKVNAMQKI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|