C23H29NO — CID 46218091
(3R,4S)-4-(dibenzylamino)-3-ethenylheptanal (PubChem CID 46218091) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (3R,4S)-4-(dibenzylamino)-3-ethenylheptanal.
| Compound Name | (3R,4S)-4-(dibenzylamino)-3-ethenylheptanal |
|---|---|
| PubChem CID | 46218091 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (3R,4S)-4-(dibenzylamino)-3-ethenylheptanal |
| SMILES | C=CC(CC=O)[C@H](CCC)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO/c1-3-11-23(22(4-2)16-17-25)24(18-20-12-7-5-8-13-20)19-21-14-9-6-10-15-21/h4-10,12-15,17,22-23H,2-3,11,16,18-19H2,1H3/t22?,23-/m0/s1 |
| InChIKey | NCGLOYYCYFOMGR-WCSIJFPASA-N |
| XLogP | 5.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|