C27H28O — CID 101048116
(2S,3S,4R)-2,3,4-tribenzylhex-5-enal (PubChem CID 101048116) has the molecular formula C27H28O and a molecular weight of 368.52 g/mol. Its IUPAC name is (2S,3S,4R)-2,3,4-tribenzylhex-5-enal.
| Compound Name | (2S,3S,4R)-2,3,4-tribenzylhex-5-enal |
|---|---|
| PubChem CID | 101048116 |
| Molecular Formula | C27H28O |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (2S,3S,4R)-2,3,4-tribenzylhex-5-enal |
| SMILES | C=C[C@@H](Cc1ccccc1)[C@H](Cc1ccccc1)[C@@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H28O/c1-2-25(18-22-12-6-3-7-13-22)27(20-24-16-10-5-11-17-24)26(21-28)19-23-14-8-4-9-15-23/h2-17,21,25-27H,1,18-20H2/t25-,26+,27-/m0/s1 |
| InChIKey | LGLVTZWIJFEPOF-VJGNERBWSA-N |
| XLogP | 5.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|