C11H12O3 — CID 102204150
(2S,3R)-2-benzyl-3-hydroxybutanedial (PubChem CID 102204150) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (2S,3R)-2-benzyl-3-hydroxybutanedial.
| Compound Name | (2S,3R)-2-benzyl-3-hydroxybutanedial |
|---|---|
| PubChem CID | 102204150 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (2S,3R)-2-benzyl-3-hydroxybutanedial |
| SMILES | O=C[C@H](O)[C@@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H12O3/c12-7-10(11(14)8-13)6-9-4-2-1-3-5-9/h1-5,7-8,10-11,14H,6H2/t10-,11+/m1/s1 |
| InChIKey | CFYJZKQYTQNWIH-MNOVXSKESA-N |
| XLogP | 0.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|