C13H18O4 — CID 102299118
(2R,3R)-2-benzyl-3-hydroxy-4,4-dimethoxybutanal (PubChem CID 102299118) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (2R,3R)-2-benzyl-3-hydroxy-4,4-dimethoxybutanal.
| Compound Name | (2R,3R)-2-benzyl-3-hydroxy-4,4-dimethoxybutanal |
|---|---|
| PubChem CID | 102299118 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2R,3R)-2-benzyl-3-hydroxy-4,4-dimethoxybutanal |
| SMILES | COC(OC)[C@H](O)[C@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H18O4/c1-16-13(17-2)12(15)11(9-14)8-10-6-4-3-5-7-10/h3-7,9,11-13,15H,8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | MJZUEAZYHFQINN-NWDGAFQWSA-N |
| XLogP | 1.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|