C20H24O3 — CID 87566123
(3R,4R)-3-hydroxy-2-[(4-methoxyphenyl)methyl]-4-methyl-5-phenylpentanal (PubChem CID 87566123) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3R,4R)-3-hydroxy-2-[(4-methoxyphenyl)methyl]-4-methyl-5-phenylpentanal.
| Compound Name | (3R,4R)-3-hydroxy-2-[(4-methoxyphenyl)methyl]-4-methyl-5-phenylpentanal |
|---|---|
| PubChem CID | 87566123 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (3R,4R)-3-hydroxy-2-[(4-methoxyphenyl)methyl]-4-methyl-5-phenylpentanal |
| SMILES | COc1ccc(CC(C=O)[C@H](O)[C@H](C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H24O3/c1-15(12-16-6-4-3-5-7-16)20(22)18(14-21)13-17-8-10-19(23-2)11-9-17/h3-11,14-15,18,20,22H,12-13H2,1-2H3/t15-,18?,20-/m1/s1 |
| InChIKey | RBNQBIZVCGXRBM-FBOUHOSPSA-N |
| XLogP | 3.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|