C18H19NO4 — CID 174292568
3-(1,3-dihydroxy-1,3-dihydroisoindol-2-yl)-2-hydroxy-4-phenylbutanal (PubChem CID 174292568) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-(1,3-dihydroxy-1,3-dihydroisoindol-2-yl)-2-hydroxy-4-phenylbutanal.
| Compound Name | 3-(1,3-dihydroxy-1,3-dihydroisoindol-2-yl)-2-hydroxy-4-phenylbutanal |
|---|---|
| PubChem CID | 174292568 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-(1,3-dihydroxy-1,3-dihydroisoindol-2-yl)-2-hydroxy-4-phenylbutanal |
| SMILES | O=CC(O)C(Cc1ccccc1)N1C(O)c2ccccc2C1O |
| InChI | InChI=1S/C18H19NO4/c20-11-16(21)15(10-12-6-2-1-3-7-12)19-17(22)13-8-4-5-9-14(13)18(19)23/h1-9,11,15-18,21-23H,10H2 |
| InChIKey | XHUSXWCSKYDXNR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|