About 3-benzyl-5-methylhexanal
3-benzyl-5-methylhexanal (PubChem CID 91400659) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is 3-benzyl-5-methylhexanal.
Molecular Properties
| Compound Name | 3-benzyl-5-methylhexanal |
| PubChem CID | 91400659 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 3-benzyl-5-methylhexanal |
| SMILES | CC(C)CC(CC=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H20O/c1-12(2)10-14(8-9-15)11-13-6-4-3-5-7-13/h3-7,9,12,14H,8,10-11H2,1-2H3 |
| InChIKey | YBGPQBLFTUWOHN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-5-methylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-5-methylhexanal?
The IUPAC name of 3-benzyl-5-methylhexanal (CID 91400659) is 3-benzyl-5-methylhexanal.
What is the SMILES notation for 3-benzyl-5-methylhexanal?
The canonical SMILES for 3-benzyl-5-methylhexanal is CC(C)CC(CC=O)Cc1ccccc1.
What is the InChIKey of 3-benzyl-5-methylhexanal?
The InChIKey is YBGPQBLFTUWOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O/c1-12(2)10-14(8-9-15)11-13-6-4-3-5-7-13/h3-7,9,12,14H,8,10-11H2,1-2H3.
What are the key properties of 3-benzyl-5-methylhexanal?
3-benzyl-5-methylhexanal has a molecular weight of 204.31 g/mol, XLogP of 3.48, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-5-methylhexanal is sourced from PubChem (CID 91400659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).