C14H23N — CID 62529459
2-benzyl-N,4-dimethylpentan-1-amine (PubChem CID 62529459) has the molecular formula C14H23N and a molecular weight of 205.35 g/mol. Its IUPAC name is 2-benzyl-N,4-dimethylpentan-1-amine.
| Compound Name | 2-benzyl-N,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 62529459 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 2-benzyl-N,4-dimethylpentan-1-amine |
| SMILES | CNCC(Cc1ccccc1)CC(C)C |
| InChI | InChI=1S/C14H23N/c1-12(2)9-14(11-15-3)10-13-7-5-4-6-8-13/h4-8,12,14-15H,9-11H2,1-3H3 |
| InChIKey | GMOGVFVFSAFCEU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |