C14H22IN — CID 65477138
2-[(4-iodophenyl)methyl]-N,4-dimethylpentan-1-amine (PubChem CID 65477138) has the molecular formula C14H22IN and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-[(4-iodophenyl)methyl]-N,4-dimethylpentan-1-amine.
| Compound Name | 2-[(4-iodophenyl)methyl]-N,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 65477138 |
| Molecular Formula | C14H22IN |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-[(4-iodophenyl)methyl]-N,4-dimethylpentan-1-amine |
| SMILES | CNCC(Cc1ccc(I)cc1)CC(C)C |
| InChI | InChI=1S/C14H22IN/c1-11(2)8-13(10-16-3)9-12-4-6-14(15)7-5-12/h4-7,11,13,16H,8-10H2,1-3H3 |
| InChIKey | FQIBZKPUNHDXJA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|