C28H34NO3P — CID 101231689
(1R,2S)-2-(dibenzylamino)-1-[ethoxy(prop-2-enyl)phosphoryl]-3-phenylpropan-1-ol (PubChem CID 101231689) has the molecular formula C28H34NO3P and a molecular weight of 463.56 g/mol. Its IUPAC name is (1R,2S)-2-(dibenzylamino)-1-[ethoxy(prop-2-enyl)phosphoryl]-3-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-(dibenzylamino)-1-[ethoxy(prop-2-enyl)phosphoryl]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 101231689 |
| Molecular Formula | C28H34NO3P |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (1R,2S)-2-(dibenzylamino)-1-[ethoxy(prop-2-enyl)phosphoryl]-3-phenylpropan-1-ol |
| SMILES | C=CCP(=O)(OCC)[C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H34NO3P/c1-3-20-33(31,32-4-2)28(30)27(21-24-14-8-5-9-15-24)29(22-25-16-10-6-11-17-25)23-26-18-12-7-13-19-26/h3,5-19,27-28,30H,1,4,20-23H2,2H3/t27-,28+,33?/m0/s1 |
| InChIKey | JDYXSGMMJVROPP-BAMOCYGKSA-N |
| XLogP | 6.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|