C10H17NO5P2 — CID 58140309
N-benzyl-ethoxy-N-[hydroxy(methyl)phosphoryl]phosphonamidic acid (PubChem CID 58140309) has the molecular formula C10H17NO5P2 and a molecular weight of 293.20 g/mol. Its IUPAC name is N-benzyl-ethoxy-N-[hydroxy(methyl)phosphoryl]phosphonamidic acid.
| Compound Name | N-benzyl-ethoxy-N-[hydroxy(methyl)phosphoryl]phosphonamidic acid |
|---|---|
| PubChem CID | 58140309 |
| Molecular Formula | C10H17NO5P2 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-benzyl-ethoxy-N-[hydroxy(methyl)phosphoryl]phosphonamidic acid |
| SMILES | CCOP(=O)(O)N(Cc1ccccc1)P(C)(=O)O |
| InChI | InChI=1S/C10H17NO5P2/c1-3-16-18(14,15)11(17(2,12)13)9-10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | JOYZWRFKORAYPZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|