C14H26N2O6P2Pt — CID 25169005
azane;[[benzyl(ethyl)amino]-[ethoxy(oxido)phosphoryl]methyl]-ethoxyphosphinate;platinum(2+) (PubChem CID 25169005) has the molecular formula C14H26N2O6P2Pt and a molecular weight of 575.40 g/mol. Its IUPAC name is azane;[[benzyl(ethyl)amino]-[ethoxy(oxido)phosphoryl]methyl]-ethoxyphosphinate;platinum(2+).
| Compound Name | azane;[[benzyl(ethyl)amino]-[ethoxy(oxido)phosphoryl]methyl]-ethoxyphosphinate;platinum(2+) |
|---|---|
| PubChem CID | 25169005 |
| Molecular Formula | C14H26N2O6P2Pt |
| Molecular Weight | 575.40 g/mol |
| Exact Mass | 575.09 |
| IUPAC Name | azane;[[benzyl(ethyl)amino]-[ethoxy(oxido)phosphoryl]methyl]-ethoxyphosphinate;platinum(2+) |
| SMILES | CCOP(=O)([O-])C(N(CC)Cc1ccccc1)P(=O)([O-])OCC.N.[Pt+2] |
| InChI | InChI=1S/C14H25NO6P2.H3N.Pt/c1-4-15(12-13-10-8-7-9-11-13)14(22(16,17)20-5-2)23(18,19)21-6-3;;/h7-11,14H,4-6,12H2,1-3H3,(H,16,17)(H,18,19);1H3;/q;;+2/p-2 |
| InChIKey | QIAAUSBRXHJRGE-UHFFFAOYSA-L |
| XLogP | 2.13 |
| TPSA | 136.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|