C14H24NO3P — CID 134929442
1-dimethoxyphosphoryl-N,N-diethyl-2-phenylethanamine (PubChem CID 134929442) has the molecular formula C14H24NO3P and a molecular weight of 285.32 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-N,N-diethyl-2-phenylethanamine.
| Compound Name | 1-dimethoxyphosphoryl-N,N-diethyl-2-phenylethanamine |
|---|---|
| PubChem CID | 134929442 |
| Molecular Formula | C14H24NO3P |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-dimethoxyphosphoryl-N,N-diethyl-2-phenylethanamine |
| SMILES | CCN(CC)C(Cc1ccccc1)P(=O)(OC)OC |
| InChI | InChI=1S/C14H24NO3P/c1-5-15(6-2)14(19(16,17-3)18-4)12-13-10-8-7-9-11-13/h7-11,14H,5-6,12H2,1-4H3 |
| InChIKey | VYGYHUXYUXIPHY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|