C12H18NO6P — CID 54098175
phosphono (2S)-2-[ethyl(methoxy)amino]-3-phenylpropanoate (PubChem CID 54098175) has the molecular formula C12H18NO6P and a molecular weight of 303.25 g/mol. Its IUPAC name is phosphono (2S)-2-[ethyl(methoxy)amino]-3-phenylpropanoate.
| Compound Name | phosphono (2S)-2-[ethyl(methoxy)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 54098175 |
| Molecular Formula | C12H18NO6P |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | phosphono (2S)-2-[ethyl(methoxy)amino]-3-phenylpropanoate |
| SMILES | CCN(OC)[C@@H](Cc1ccccc1)C(=O)OP(=O)(O)O |
| InChI | InChI=1S/C12H18NO6P/c1-3-13(18-2)11(12(14)19-20(15,16)17)9-10-7-5-4-6-8-10/h4-8,11H,3,9H2,1-2H3,(H2,15,16,17)/t11-/m0/s1 |
| InChIKey | MYPYXDADNPDTKJ-NSHDSACASA-N |
| XLogP | 1.12 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|