C11H17N2O6P — CID 154073361
amino-(1-phenyl-3-phosphonooxybutan-2-yl)carbamic acid (PubChem CID 154073361) has the molecular formula C11H17N2O6P and a molecular weight of 304.24 g/mol. Its IUPAC name is amino-(1-phenyl-3-phosphonooxybutan-2-yl)carbamic acid.
| Compound Name | amino-(1-phenyl-3-phosphonooxybutan-2-yl)carbamic acid |
|---|---|
| PubChem CID | 154073361 |
| Molecular Formula | C11H17N2O6P |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | amino-(1-phenyl-3-phosphonooxybutan-2-yl)carbamic acid |
| SMILES | CC(OP(=O)(O)O)C(Cc1ccccc1)N(N)C(=O)O |
| InChI | InChI=1S/C11H17N2O6P/c1-8(19-20(16,17)18)10(13(12)11(14)15)7-9-5-3-2-4-6-9/h2-6,8,10H,7,12H2,1H3,(H,14,15)(H2,16,17,18) |
| InChIKey | GIDVRPDAMDBYRZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|