C14H20NO6P — CID 70093301
3-amino-5-benzyl-2-methyl-4-oxo-6-phosphonohexanoic acid (PubChem CID 70093301) has the molecular formula C14H20NO6P and a molecular weight of 329.29 g/mol. Its IUPAC name is 3-amino-5-benzyl-2-methyl-4-oxo-6-phosphonohexanoic acid.
| Compound Name | 3-amino-5-benzyl-2-methyl-4-oxo-6-phosphonohexanoic acid |
|---|---|
| PubChem CID | 70093301 |
| Molecular Formula | C14H20NO6P |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-amino-5-benzyl-2-methyl-4-oxo-6-phosphonohexanoic acid |
| SMILES | CC(C(=O)O)C(N)C(=O)C(Cc1ccccc1)CP(=O)(O)O |
| InChI | InChI=1S/C14H20NO6P/c1-9(14(17)18)12(15)13(16)11(8-22(19,20)21)7-10-5-3-2-4-6-10/h2-6,9,11-12H,7-8,15H2,1H3,(H,17,18)(H2,19,20,21) |
| InChIKey | RPZGMIGXNNQAEB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|