C13H18NO7P — CID 70066933
3-[(2-benzyl-3-phosphonopropanoyl)amino]-2-hydroxypropanoic acid (PubChem CID 70066933) has the molecular formula C13H18NO7P and a molecular weight of 331.26 g/mol. Its IUPAC name is 3-[(2-benzyl-3-phosphonopropanoyl)amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(2-benzyl-3-phosphonopropanoyl)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 70066933 |
| Molecular Formula | C13H18NO7P |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 3-[(2-benzyl-3-phosphonopropanoyl)amino]-2-hydroxypropanoic acid |
| SMILES | O=C(O)C(O)CNC(=O)C(Cc1ccccc1)CP(=O)(O)O |
| InChI | InChI=1S/C13H18NO7P/c15-11(13(17)18)7-14-12(16)10(8-22(19,20)21)6-9-4-2-1-3-5-9/h1-5,10-11,15H,6-8H2,(H,14,16)(H,17,18)(H2,19,20,21) |
| InChIKey | YMZCQQSTZANVRU-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|