C10H13O6P — CID 11065160
2-[(3-hydroxyphenyl)methyl]-3-phosphonopropanoic acid (PubChem CID 11065160) has the molecular formula C10H13O6P and a molecular weight of 260.18 g/mol. Its IUPAC name is 2-[(3-hydroxyphenyl)methyl]-3-phosphonopropanoic acid.
| Compound Name | 2-[(3-hydroxyphenyl)methyl]-3-phosphonopropanoic acid |
|---|---|
| PubChem CID | 11065160 |
| Molecular Formula | C10H13O6P |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-[(3-hydroxyphenyl)methyl]-3-phosphonopropanoic acid |
| SMILES | O=C(O)C(Cc1cccc(O)c1)CP(=O)(O)O |
| InChI | InChI=1S/C10H13O6P/c11-9-3-1-2-7(5-9)4-8(10(12)13)6-17(14,15)16/h1-3,5,8,11H,4,6H2,(H,12,13)(H2,14,15,16) |
| InChIKey | HIMJXLQMQZPAMM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|