C13H16NO6P — CID 70068983
2-amino-5-benzyl-4-oxo-6-phosphonohex-2-enoic acid (PubChem CID 70068983) has the molecular formula C13H16NO6P and a molecular weight of 313.25 g/mol. Its IUPAC name is 2-amino-5-benzyl-4-oxo-6-phosphonohex-2-enoic acid.
| Compound Name | 2-amino-5-benzyl-4-oxo-6-phosphonohex-2-enoic acid |
|---|---|
| PubChem CID | 70068983 |
| Molecular Formula | C13H16NO6P |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-amino-5-benzyl-4-oxo-6-phosphonohex-2-enoic acid |
| SMILES | NC(=CC(=O)C(Cc1ccccc1)CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C13H16NO6P/c14-11(13(16)17)7-12(15)10(8-21(18,19)20)6-9-4-2-1-3-5-9/h1-5,7,10H,6,8,14H2,(H,16,17)(H2,18,19,20) |
| InChIKey | BUPXBZPMWRKAFL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|