About 2-benzylheptanediamide
2-benzylheptanediamide (PubChem CID 154384370) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-benzylheptanediamide.
Molecular Properties
| Compound Name | 2-benzylheptanediamide |
| PubChem CID | 154384370 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-benzylheptanediamide |
| SMILES | NC(=O)CCCCC(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C14H20N2O2/c15-13(17)9-5-4-8-12(14(16)18)10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H2,15,17)(H2,16,18) |
| InChIKey | VBJWLGUISKBGJT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylheptanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylheptanediamide?
The IUPAC name of 2-benzylheptanediamide (CID 154384370) is 2-benzylheptanediamide.
What is the SMILES notation for 2-benzylheptanediamide?
The canonical SMILES for 2-benzylheptanediamide is NC(=O)CCCCC(Cc1ccccc1)C(N)=O.
What is the InChIKey of 2-benzylheptanediamide?
The InChIKey is VBJWLGUISKBGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c15-13(17)9-5-4-8-12(14(16)18)10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H2,15,17)(H2,16,18).
What are the key properties of 2-benzylheptanediamide?
2-benzylheptanediamide has a molecular weight of 248.33 g/mol, XLogP of 1.38, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylheptanediamide is sourced from PubChem (CID 154384370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).