C33H44O8 — CID 68807133
8-benzyl-9-[(2-benzyl-8-carboxyoctanoyl)oxymethoxy]-9-oxononanoic acid (PubChem CID 68807133) has the molecular formula C33H44O8 and a molecular weight of 568.71 g/mol. Its IUPAC name is 8-benzyl-9-[(2-benzyl-8-carboxyoctanoyl)oxymethoxy]-9-oxononanoic acid.
| Compound Name | 8-benzyl-9-[(2-benzyl-8-carboxyoctanoyl)oxymethoxy]-9-oxononanoic acid |
|---|---|
| PubChem CID | 68807133 |
| Molecular Formula | C33H44O8 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 8-benzyl-9-[(2-benzyl-8-carboxyoctanoyl)oxymethoxy]-9-oxononanoic acid |
| SMILES | O=C(O)CCCCCCC(Cc1ccccc1)C(=O)OCOC(=O)C(CCCCCCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C33H44O8/c34-30(35)21-13-3-1-11-19-28(23-26-15-7-5-8-16-26)32(38)40-25-41-33(39)29(24-27-17-9-6-10-18-27)20-12-2-4-14-22-31(36)37/h5-10,15-18,28-29H,1-4,11-14,19-25H2,(H,34,35)(H,36,37) |
| InChIKey | SXFOXNNVWOCIAK-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|