C13H18NO5P — CID 67918808
(4-amino-2-methyl-5-oxo-5-phenylmethoxypent-3-enyl)phosphonic acid (PubChem CID 67918808) has the molecular formula C13H18NO5P and a molecular weight of 299.26 g/mol. Its IUPAC name is (4-amino-2-methyl-5-oxo-5-phenylmethoxypent-3-enyl)phosphonic acid.
| Compound Name | (4-amino-2-methyl-5-oxo-5-phenylmethoxypent-3-enyl)phosphonic acid |
|---|---|
| PubChem CID | 67918808 |
| Molecular Formula | C13H18NO5P |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (4-amino-2-methyl-5-oxo-5-phenylmethoxypent-3-enyl)phosphonic acid |
| SMILES | CC(C=C(N)C(=O)OCc1ccccc1)CP(=O)(O)O |
| InChI | InChI=1S/C13H18NO5P/c1-10(9-20(16,17)18)7-12(14)13(15)19-8-11-5-3-2-4-6-11/h2-7,10H,8-9,14H2,1H3,(H2,16,17,18) |
| InChIKey | DVEQOGWJZZWCBF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|