C13H17O5P — CID 59235825
methyl-(2-methyl-3,4-dioxo-4-phenylmethoxybutyl)phosphinic acid (PubChem CID 59235825) has the molecular formula C13H17O5P and a molecular weight of 284.25 g/mol. Its IUPAC name is methyl-(2-methyl-3,4-dioxo-4-phenylmethoxybutyl)phosphinic acid.
| Compound Name | methyl-(2-methyl-3,4-dioxo-4-phenylmethoxybutyl)phosphinic acid |
|---|---|
| PubChem CID | 59235825 |
| Molecular Formula | C13H17O5P |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl-(2-methyl-3,4-dioxo-4-phenylmethoxybutyl)phosphinic acid |
| SMILES | CC(CP(C)(=O)O)C(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17O5P/c1-10(9-19(2,16)17)12(14)13(15)18-8-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | MLDLZTGEVFWIRN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|