C19H23N2O6P — CID 70068223
(2S)-3-phenyl-2-[(1-phenyl-3-phosphonopropan-2-yl)carbamoylamino]propanoic acid (PubChem CID 70068223) has the molecular formula C19H23N2O6P and a molecular weight of 406.38 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[(1-phenyl-3-phosphonopropan-2-yl)carbamoylamino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[(1-phenyl-3-phosphonopropan-2-yl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 70068223 |
| Molecular Formula | C19H23N2O6P |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2S)-3-phenyl-2-[(1-phenyl-3-phosphonopropan-2-yl)carbamoylamino]propanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)CP(=O)(O)O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H23N2O6P/c22-18(23)17(12-15-9-5-2-6-10-15)21-19(24)20-16(13-28(25,26)27)11-14-7-3-1-4-8-14/h1-10,16-17H,11-13H2,(H,22,23)(H2,20,21,24)(H2,25,26,27)/t16?,17-/m0/s1 |
| InChIKey | HLCTVMOFYAFYMU-DJNXLDHESA-N |
| XLogP | 1.77 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|