C12H17NO — CID 140571501
(3R)-2,3-dimethyl-4-phenylbutanamide (PubChem CID 140571501) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (3R)-2,3-dimethyl-4-phenylbutanamide.
| Compound Name | (3R)-2,3-dimethyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 140571501 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (3R)-2,3-dimethyl-4-phenylbutanamide |
| SMILES | CC(C(N)=O)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO/c1-9(10(2)12(13)14)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H2,13,14)/t9-,10?/m1/s1 |
| InChIKey | JIMHOYCPBPMGDD-YHMJZVADSA-N |
| XLogP | 1.99 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |