C11H17N2O6P — CID 140615775
amino N-(1-phenyl-3-phosphonooxybutan-2-yl)carbamate (PubChem CID 140615775) has the molecular formula C11H17N2O6P and a molecular weight of 304.24 g/mol. Its IUPAC name is amino N-(1-phenyl-3-phosphonooxybutan-2-yl)carbamate.
| Compound Name | amino N-(1-phenyl-3-phosphonooxybutan-2-yl)carbamate |
|---|---|
| PubChem CID | 140615775 |
| Molecular Formula | C11H17N2O6P |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | amino N-(1-phenyl-3-phosphonooxybutan-2-yl)carbamate |
| SMILES | CC(OP(=O)(O)O)C(Cc1ccccc1)NC(=O)ON |
| InChI | InChI=1S/C11H17N2O6P/c1-8(19-20(15,16)17)10(13-11(14)18-12)7-9-5-3-2-4-6-9/h2-6,8,10H,7,12H2,1H3,(H,13,14)(H2,15,16,17) |
| InChIKey | WTSOZDNUYSRUBX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|