C15H18NO3P — CID 139059161
ethoxy-[(R)-phenyl-(phenylazaniumyl)methyl]phosphinate (PubChem CID 139059161) has the molecular formula C15H18NO3P and a molecular weight of 291.29 g/mol. Its IUPAC name is ethoxy-[(R)-phenyl-(phenylazaniumyl)methyl]phosphinate.
| Compound Name | ethoxy-[(R)-phenyl-(phenylazaniumyl)methyl]phosphinate |
|---|---|
| PubChem CID | 139059161 |
| Molecular Formula | C15H18NO3P |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethoxy-[(R)-phenyl-(phenylazaniumyl)methyl]phosphinate |
| SMILES | CCOP(=O)([O-])[C@@H]([NH2+]c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H18NO3P/c1-2-19-20(17,18)15(13-9-5-3-6-10-13)16-14-11-7-4-8-12-14/h3-12,15-16H,2H2,1H3,(H,17,18)/t15-/m1/s1 |
| InChIKey | FXIAAFILGDDMRW-OAHLLOKOSA-N |
| XLogP | 2.17 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|