C21H23N3NaO4P — CID 23696684
sodium;ethoxy-[phenyl-(4-phenyldiazenylanilino)methyl]phosphinate;hydrate (PubChem CID 23696684) has the molecular formula C21H23N3NaO4P and a molecular weight of 435.40 g/mol. Its IUPAC name is sodium;ethoxy-[phenyl-(4-phenyldiazenylanilino)methyl]phosphinate;hydrate.
| Compound Name | sodium;ethoxy-[phenyl-(4-phenyldiazenylanilino)methyl]phosphinate;hydrate |
|---|---|
| PubChem CID | 23696684 |
| Molecular Formula | C21H23N3NaO4P |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | sodium;ethoxy-[phenyl-(4-phenyldiazenylanilino)methyl]phosphinate;hydrate |
| SMILES | CCOP(=O)([O-])C(Nc1ccc(/N=N/c2ccccc2)cc1)c1ccccc1.O.[Na+] |
| InChI | InChI=1S/C21H22N3O3P.Na.H2O/c1-2-27-28(25,26)21(17-9-5-3-6-10-17)22-18-13-15-20(16-14-18)24-23-19-11-7-4-8-12-19;;/h3-16,21-22H,2H2,1H3,(H,25,26);;1H2/q;+1;/p-1/b24-23+;; |
| InChIKey | ZXXICDVTYXHEKO-KPOOZVEVSA-M |
| XLogP | 1.98 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|