C19H25NNaO7P — CID 146077788
sodium ethoxy-[(4-methoxyanilino)-(3,4,5-trimethoxyphenyl)methyl]phosphinate (PubChem CID 146077788) has the molecular formula C19H25NNaO7P and a molecular weight of 433.37 g/mol. Its IUPAC name is sodium ethoxy-[(4-methoxyanilino)-(3,4,5-trimethoxyphenyl)methyl]phosphinate.
| Compound Name | sodium ethoxy-[(4-methoxyanilino)-(3,4,5-trimethoxyphenyl)methyl]phosphinate |
|---|---|
| PubChem CID | 146077788 |
| Molecular Formula | C19H25NNaO7P |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | sodium ethoxy-[(4-methoxyanilino)-(3,4,5-trimethoxyphenyl)methyl]phosphinate |
| SMILES | CCOP(=O)([O-])C(Nc1ccc(OC)cc1)c1cc(OC)c(OC)c(OC)c1.[Na+] |
| InChI | InChI=1S/C19H26NO7P.Na/c1-6-27-28(21,22)19(20-14-7-9-15(23-2)10-8-14)13-11-16(24-3)18(26-5)17(12-13)25-4;/h7-12,19-20H,6H2,1-5H3,(H,21,22);/q;+1/p-1 |
| InChIKey | UQZFDTAXRLJFAC-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|