C24H32ClF3NO7P — CID 21210744
4-(2-chloro-1,1,2-trifluoroethoxy)-N-[di(propan-2-yloxy)phosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline (PubChem CID 21210744) has the molecular formula C24H32ClF3NO7P and a molecular weight of 569.94 g/mol. Its IUPAC name is 4-(2-chloro-1,1,2-trifluoroethoxy)-N-[di(propan-2-yloxy)phosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline.
| Compound Name | 4-(2-chloro-1,1,2-trifluoroethoxy)-N-[di(propan-2-yloxy)phosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 21210744 |
| Molecular Formula | C24H32ClF3NO7P |
| Molecular Weight | 569.94 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | 4-(2-chloro-1,1,2-trifluoroethoxy)-N-[di(propan-2-yloxy)phosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline |
| SMILES | COc1cc(C(Nc2ccc(OC(F)(F)C(F)Cl)cc2)P(=O)(OC(C)C)OC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C24H32ClF3NO7P/c1-14(2)35-37(30,36-15(3)4)22(16-12-19(31-5)21(33-7)20(13-16)32-6)29-17-8-10-18(11-9-17)34-24(27,28)23(25)26/h8-15,22-23,29H,1-7H3 |
| InChIKey | HZLUGLBAEPHRSY-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.94 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|