C22H31ClNO6P — CID 21210732
2-chloro-N-[di(propan-2-yloxy)phosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline (PubChem CID 21210732) has the molecular formula C22H31ClNO6P and a molecular weight of 471.92 g/mol. Its IUPAC name is 2-chloro-N-[di(propan-2-yloxy)phosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline.
| Compound Name | 2-chloro-N-[di(propan-2-yloxy)phosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 21210732 |
| Molecular Formula | C22H31ClNO6P |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 2-chloro-N-[di(propan-2-yloxy)phosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline |
| SMILES | COc1cc(C(Nc2ccccc2Cl)P(=O)(OC(C)C)OC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C22H31ClNO6P/c1-14(2)29-31(25,30-15(3)4)22(24-18-11-9-8-10-17(18)23)16-12-19(26-5)21(28-7)20(13-16)27-6/h8-15,22,24H,1-7H3 |
| InChIKey | ZRTPAWPNVHDMSQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|