C21H37NO7P2S — CID 54403537
2,2-bis[di(propan-2-yloxy)phosphoryl]-N-(2-methoxyphenyl)ethanethioamide (PubChem CID 54403537) has the molecular formula C21H37NO7P2S and a molecular weight of 509.54 g/mol. Its IUPAC name is 2,2-bis[di(propan-2-yloxy)phosphoryl]-N-(2-methoxyphenyl)ethanethioamide.
| Compound Name | 2,2-bis[di(propan-2-yloxy)phosphoryl]-N-(2-methoxyphenyl)ethanethioamide |
|---|---|
| PubChem CID | 54403537 |
| Molecular Formula | C21H37NO7P2S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 2,2-bis[di(propan-2-yloxy)phosphoryl]-N-(2-methoxyphenyl)ethanethioamide |
| SMILES | COc1ccccc1NC(=S)C(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C21H37NO7P2S/c1-14(2)26-30(23,27-15(3)4)21(31(24,28-16(5)6)29-17(7)8)20(32)22-18-12-10-11-13-19(18)25-9/h10-17,21H,1-9H3,(H,22,32) |
| InChIKey | VPCJQCJLIUEEKQ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|