C32H26N2O4S — CID 3660329
2-N,5-N-bis(2-methoxyphenyl)-3,4-diphenylthiophene-2,5-dicarboxamide (PubChem CID 3660329) has the molecular formula C32H26N2O4S and a molecular weight of 534.64 g/mol. Its IUPAC name is 2-N,5-N-bis(2-methoxyphenyl)-3,4-diphenylthiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(2-methoxyphenyl)-3,4-diphenylthiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 3660329 |
| Molecular Formula | C32H26N2O4S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 2-N,5-N-bis(2-methoxyphenyl)-3,4-diphenylthiophene-2,5-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)c1sc(C(=O)Nc2ccccc2OC)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C32H26N2O4S/c1-37-25-19-11-9-17-23(25)33-31(35)29-27(21-13-5-3-6-14-21)28(22-15-7-4-8-16-22)30(39-29)32(36)34-24-18-10-12-20-26(24)38-2/h3-20H,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | YBGOESWXVGQWFX-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |