C10H12N2OS2 — CID 86107307
N'-(2-methoxyphenyl)propanedithioamide (PubChem CID 86107307) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N'-(2-methoxyphenyl)propanedithioamide.
| Compound Name | N'-(2-methoxyphenyl)propanedithioamide |
|---|---|
| PubChem CID | 86107307 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | N'-(2-methoxyphenyl)propanedithioamide |
| SMILES | COc1ccccc1NC(=S)CC(N)=S |
| InChI | InChI=1S/C10H12N2OS2/c1-13-8-5-3-2-4-7(8)12-10(15)6-9(11)14/h2-5H,6H2,1H3,(H2,11,14)(H,12,15) |
| InChIKey | NYEBPPLQERVOAS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|