C10H14N4O2 — CID 4991836
2-(diaminomethylideneamino)-N-(2-methoxyphenyl)acetamide (PubChem CID 4991836) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(diaminomethylideneamino)-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4991836 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-(diaminomethylideneamino)-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN=C(N)N |
| InChI | InChI=1S/C10H14N4O2/c1-16-8-5-3-2-4-7(8)14-9(15)6-13-10(11)12/h2-5H,6H2,1H3,(H,14,15)(H4,11,12,13) |
| InChIKey | VYLMWLLPKOLTOK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|