C13H19N3O3 — CID 60864309
4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]butanamide (PubChem CID 60864309) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]butanamide.
| Compound Name | 4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]butanamide |
|---|---|
| PubChem CID | 60864309 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-[[2-(2-methoxyanilino)-2-oxoethyl]amino]butanamide |
| SMILES | COc1ccccc1NC(=O)CNCCCC(N)=O |
| InChI | InChI=1S/C13H19N3O3/c1-19-11-6-3-2-5-10(11)16-13(18)9-15-8-4-7-12(14)17/h2-3,5-6,15H,4,7-9H2,1H3,(H2,14,17)(H,16,18) |
| InChIKey | CSEKGOJTTMALKQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|