C13H20N2O4 — CID 55024321
2-[2-(2-hydroxyethoxy)ethylamino]-N-(2-methoxyphenyl)acetamide (PubChem CID 55024321) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethylamino]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethylamino]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55024321 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethylamino]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CNCCOCCO |
| InChI | InChI=1S/C13H20N2O4/c1-18-12-5-3-2-4-11(12)15-13(17)10-14-6-8-19-9-7-16/h2-5,14,16H,6-10H2,1H3,(H,15,17) |
| InChIKey | CFLXLRRUXSNORR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|